A7764412
p-Toluenesulfonic acid monohydrate , ACS,≥98.5% , 6192-52-5
Synonym(s):
p-Toluenesulfonic acid monohydrate;p-Toluenesulfonic Acid, Monohydrate;1-Hydrate;p-Toluenesulfonic acid, Tosylic acid, Tosic acid, PTSA;Toluene-4-sulfonic acid monohydrate
CAS NO.:6192-52-5
Empirical Formula: C7H10O4S
Molecular Weight: 190.22
MDL number: MFCD00142137
EINECS: 203-180-0
| Pack Size | Price | Stock | Quantity |
| 100G | RMB70.40 | In Stock |
|
| 500G | RMB182.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 96-99 °C(lit.) |
| Boiling point: | 140°C 20mm |
| bulk density | 510kg/m3 |
| Density | 1,24 g/cm3 |
| vapor density | 5.9 (vs air) |
| refractive index | 1,382-1,384 |
| Flash point: | 180 °C |
| storage temp. | Store at +5°C to +30°C. |
| solubility | H2O: 0.1 g/mL, clear |
| form | Solid |
| Colour Index | 42655 |
| color | White to pink |
| PH | 1 (650g/l, H2O, 20℃)(anhydrous substance) |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| Merck | 14,9533 |
| BRN | 3568023 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases, most common metals. Protect from moisture. |
| InChI | 1S/C7H8O3S.H2O/c1-6-2-4-7(5-3-6)11(8,9)10;/h2-5H,1H3,(H,8,9,10);1H2 |
| InChIKey | KJIFKLIQANRMOU-UHFFFAOYSA-N |
| SMILES | [H]O[H].Cc1ccc(cc1)S(O)(=O)=O |
| CAS DataBase Reference | 6192-52-5(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonic acid, 4-methyl-, monohydrate (6192-52-5) |
Description and Uses
p-Toluenesulfonic acid monohydrate (p-TsOH·H2O) may be used as a catalyst in the synthesis of the following:
- Unsymmetrical benzils.
- Highly substituted piperidines.
- 1,3,5-Trisubstituted benzenes by trimerization of alkynes.
- Triazoloquinazolinone and benzimidazoquinazolinone derivatives.
- 1,3,5-Trisubstituted pyrazoles derivatives.
- Selenated ketene dithioacetals.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H290-H314-H335-H412 |
| Precautionary statements | P234-P260-P273-P280-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38-34-37 |
| Safety Statements | 26-37-45-36/37/39 |
| RIDADR | UN 2585 8/PG 3 |
| WGK Germany | - |
| RTECS | XT6300000 |
| F | 3 |
| Autoignition Temperature | 600 °C |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29041000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Met. Corr. 1 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 orally in Rabbit: 2570 mg/kg |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







