A7764558
Isorhamnetin-3-O-nehesperidine , 10mMinDMSO , 55033-90-4
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >195oC (dec.) |
| Boiling point: | 956.8±65.0 °C(Predicted) |
| Density | 1.74 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly), Pyridine (Slightly) |
| pka | 6.17±0.40(Predicted) |
| form | Solid |
| color | Light Yellow to Yellow |
| Stability: | Hygroscopic |
| Major Application | food and beverages |
| InChIKey | QHLKSZBFIJJREC-PSKHSWTNNA-N |
| SMILES | O1C(C(C(C(C1C)O)O)O)OC2C(OC(C(C2O)O)CO)OC3=C(Oc5c(c(cc(c5)O)O)C3=O)c4cc(c(cc4)O)OC |
Description and Uses
Isorhamnetin 3-O-neohesperidine is a flavonol glycoside extract used as an anti-oxidant.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |





