A7770758
Farnesol , 10mMinDMSO , 4602-84-0
Synonym(s):
3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol
CAS NO.:4602-84-0
Empirical Formula: C15H26O
Molecular Weight: 222.37
MDL number: MFCD00002918
EINECS: 225-004-1
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25°C |
| Boiling point: | 149 °C4 mm Hg(lit.) |
| Density | 0.886 g/mL at 20 °C(lit.) |
| vapor pressure | 13Pa at 20℃ |
| FEMA | 2478 | FARNESOL |
| refractive index | n |
| Flash point: | 205 °F |
| storage temp. | 2-8°C |
| solubility | DMSO:100.0(Max Conc. mg/mL);449.7(Max Conc. mM) |
| pka | 14.69±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless to faint yellow |
| Odor | at 100.00 %. mild fresh sweet linden floral angelica |
| Odor Type | floral |
| biological source | synthetic |
| Water Solubility | Not miscible or difficult to mix in water. |
| Sensitive | Light Sensitive |
| Merck | 14,3937 |
| JECFA Number | 1230 |
| BRN | 1763926 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING DEODORANT |
| InChI | 1S/C15H26O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3/b14-9+,15-11+ |
| InChIKey | CRDAMVZIKSXKFV-YFVJMOTDSA-N |
| SMILES | C/C(CC/C=C(C)/CCC=C(C)C)=C\CO |
| LogP | 4.72 at 22.3℃ |
| CAS DataBase Reference | 4602-84-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-(4602-84-0) |
| EPA Substance Registry System | Farnesol (4602-84-0) |
Description and Uses
Farnesol has a characteristic flowery odor.
It can be used to induce apoptosis in cell cultures. It is also used as an antimicrobial agent. It is used in perfumes and as a flavoring agent.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H317-H410 |
| Precautionary statements | P261-P264-P272-P273-P280-P302+P352 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi |
| Safety Statements | 24/25-22 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 3 |
| RTECS | JR4979000 |
| F | 8 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 9 |
| HS Code | 29052200 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Skin Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 4602-84-0(Hazardous Substances Data) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








