A7770858
Glabridin , 10mMinDMSO , 59870-68-7
Synonym(s):
(R)-4-(3,4-Dihydro-8,8-dimethyl-2H,8H-benzo[1,2-b:3,4-b′]dipyran-3-yl)-1,3-benzenediol;4-[(3R)-3,4-Dihydro-8,8-dimethyl-2H,8H-benzo[1,2-b:3,4-b′]dipyran-3-yl]-1,3-benzenediol;Glabridin
CAS NO.:59870-68-7
Empirical Formula: C20H20O4
Molecular Weight: 324.37
MDL number: MFCD03427694
EINECS: 611-908-7
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154~155℃ |
| Boiling point: | 518.6±50.0 °C(Predicted) |
| Density | 1.257±0.06 g/cm3(Predicted) |
| Flash point: | 267℃ |
| storage temp. | room temp |
| solubility | DMSO: soluble5mg/mL, clear (warmed) |
| form | powder |
| pka | 9.66±0.40(Predicted) |
| color | white to light brown |
| BRN | 7141956 |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | BLEACHING |
| InChI | InChI=1S/C20H20O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1 |
| InChIKey | PMPYOYXFIHXBJI-ZDUSSCGKSA-N |
| SMILES | C1(O)=CC=C([C@@H]2COC3=C4C=CC(C)(C)OC4=CC=C3C2)C(O)=C1 |
| LogP | 4.260 (est) |
| CAS DataBase Reference | 59870-68-7(CAS DataBase Reference) |
Description and Uses
Glabridin is a compound extracted from Licorice (root) shows properties that are cytotoxic, antimicrobial, estrogenic and anti-proliferative.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29329990 |






