A7770858
                    Glabridin , 10mMinDMSO , 59870-68-7
                            Synonym(s):
(R)-4-(3,4-Dihydro-8,8-dimethyl-2H,8H-benzo[1,2-b:3,4-b′]dipyran-3-yl)-1,3-benzenediol;4-[(3R)-3,4-Dihydro-8,8-dimethyl-2H,8H-benzo[1,2-b:3,4-b′]dipyran-3-yl]-1,3-benzenediol;Glabridin
                            
                        
                CAS NO.:59870-68-7
Empirical Formula: C20H20O4
Molecular Weight: 324.37
MDL number: MFCD03427694
EINECS: 611-908-7
| Pack Size | Price | Stock | Quantity | 
| 1ml | RMB159.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 154~155℃ | 
                                    
| Boiling point: | 518.6±50.0 °C(Predicted) | 
                                    
| Density | 1.257±0.06 g/cm3(Predicted) | 
                                    
| Flash point: | 267℃ | 
                                    
| storage temp. | room temp | 
                                    
| solubility | DMSO: soluble5mg/mL, clear (warmed) | 
                                    
| form | powder | 
                                    
| pka | 9.66±0.40(Predicted) | 
                                    
| color | white to light brown | 
                                    
| BRN | 7141956 | 
                                    
| Stability: | Hygroscopic | 
                                    
| InChI | InChI=1S/C20H20O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1 | 
                                    
| InChIKey | PMPYOYXFIHXBJI-ZDUSSCGKSA-N | 
                                    
| SMILES | C1(O)=CC=C([C@@H]2COC3=C4C=CC(C)(C)OC4=CC=C3C2)C(O)=C1 | 
                                    
| LogP | 4.260 (est) | 
                                    
| CAS DataBase Reference | 59870-68-7(CAS DataBase Reference) | 
                                    
Description and Uses
Glabridin is a compound extracted from Licorice (root) shows properties that are cytotoxic, antimicrobial, estrogenic and anti-proliferative.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302+H312+H332 | 
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 | 
| Safety Statements | 24/25 | 
| WGK Germany | 3 | 
| HS Code | 29329990 | 






