A7771712
Tetrapropylammonium bromide , Ion to chromatography, ≥99.0%(AT) , 1941-30-6
Synonym(s):
Tetrapropylammonium bromide
CAS NO.:1941-30-6
Empirical Formula: C12H28BrN
Molecular Weight: 266.27
MDL number: MFCD00011840
EINECS: 217-727-6
| Pack Size | Price | Stock | Quantity |
| 10G | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 266-272 °C |
| Density | 1.1949 (rough estimate) |
| refractive index | 1.5260 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | H2O: 0.1 g/mL, clear |
| form | Crystals or Crystalline Powder |
| color | White |
| PH | 5-7 (100g/l, H2O) |
| Odor | Odorless |
| Water Solubility | 100 g/L |
| Sensitive | Hygroscopic |
| λmax | λ: 240 nm Amax: 0.04 λ: 250 nm Amax: 0.03 λ: 260 nm Amax: 0.02 λ: 500 nm Amax: 0.02 |
| BRN | 3567846 |
| InChI | 1S/C12H28N.BrH/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | JRMUNVKIHCOMHV-UHFFFAOYSA-M |
| SMILES | [Br-].CCC[N+](CCC)(CCC)CCC |
| LogP | -0.3 at 20℃ |
| CAS DataBase Reference | 1941-30-6(CAS DataBase Reference) |
| EPA Substance Registry System | Tetrapropylammonium bromide (1941-30-6) |
Description and Uses
Supporting electrolyte
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | BS8390000 |
| F | 3 |
| TSCA | TSCA listed |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 orally in Rabbit: 3500 mg/kg |





