A7772558
Losartan , 10mMinDMSO , 114798-26-4
Synonym(s):
1-[1-[[2′-(2H-Tetrazol-5-yl)biphenyl-4-yl]methyl]-2-butyl-4-chloro-1H-imidazol-5-yl]methanol;2-Butyl-4-chloro-1-[[2′-(1H-tetrazol-5-yl)-1,1′-biphenyl-4-yl]methyl]-1H-imidazole-5-methanol;2-Butyl-4-chloro-1-[[2′-(2H-tetrazol-5-yl)[1,1′-biphenyl]-4-yl]methyl]-1H-imidazole-5-methanol;DUP 89
CAS NO.:114798-26-4
Empirical Formula: C22H23ClN6O
Molecular Weight: 422.91
MDL number: MFCD00865831
EINECS: 601-329-8
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 183-184 C |
| Boiling point: | 682.0±65.0 °C(Predicted) |
| Density | 1.35±0.1 g/cm3(Predicted) |
| vapor pressure | 0.002Pa at 20℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 5-6(at 25℃) |
| color | White to Off-White |
| Water Solubility | 4.8mg/L at 20℃ |
| InChI | 1S/C22H23ClN6O/c1-2-3-8-20-24-21(23)19(14-30)29(20)13-15-9-11-16(12-10-15)17-6-4-5-7-18(17)22-25-27-28-26-22/h4-7,9-12,30H,2-3,8,13-14H2,1H3,(H,25,26,27,28) |
| InChIKey | PSIFNNKUMBGKDQ-UHFFFAOYSA-N |
| SMILES | OCC1=C(Cl)N=C(CCCC)N1CC2=CC=C(C3=C(C4=NNN=N4)C=CC=C3)C=C2 |
| LogP | 1.1 at 20℃ |
| CAS DataBase Reference | 114798-26-4(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Imidazole-5-methanol, 2-butyl-4-chloro-1-[[2'-(2H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl]- (114798-26-4) |
Description and Uses
Losartan is a nonpeptide angiotensin II AT1-receptor antagonist. Antihypertensive.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H360FD-H362 |
| Precautionary statements | P202-P260-P263-P280-P302+P352-P308+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Lact. Repr. 1B Skin Sens. 1 |
| Hazardous Substances Data | 114798-26-4(Hazardous Substances Data) |






