A7772658
Prazosin , 10mMinDMSO , 19216-56-9
CAS NO.:19216-56-9
Empirical Formula: C19H21N5O4
Molecular Weight: 383.4
MDL number: MFCD00599563
EINECS: 242-885-8
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 278-280°C |
| Boiling point: | 510.33°C (rough estimate) |
| Density | 1.3275 (rough estimate) |
| refractive index | 1.7600 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | pKa 6.54(50% EtOH) (Uncertain) |
| color | White to Off-White |
| Water Solubility | 3.2mg/L(22.5 ºC) |
| InChI | InChI=1S/C19H21N5O4/c1-26-15-10-12-13(11-16(15)27-2)21-19(22-17(12)20)24-7-5-23(6-8-24)18(25)14-4-3-9-28-14/h3-4,9-11H,5-8H2,1-2H3,(H2,20,21,22) |
| InChIKey | IENZQIKPVFGBNW-UHFFFAOYSA-N |
| SMILES | C(N1CCN(C2=NC(N)=C3C(=N2)C=C(OC)C(OC)=C3)CC1)(C1=CC=CO1)=O |
Description and Uses
Prazosin is used for treating mid-to-moderate hypertension. When using this drug, blood pressure is reduced without any significant change in indicators of cardiac function such as frequency, coronary flow, or cardiac output.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |




