A7775512
2,4,6-Trimethylphenylboronic acid , 98% , 5980-97-2
Synonym(s):
2,4,6-Trimethylbenzeneboronic acid;Mesitylene-2-boronic acid;NSC 157832
| Pack Size | Price | Stock | Quantity |
| 1G | RMB29.60 | In Stock |
|
| 5G | RMB81.60 | In Stock |
|
| 25G | RMB293.60 | In Stock |
|
| 100g | RMB1240.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-122 °C (lit.) |
| Boiling point: | 309.1±52.0 °C(Predicted) |
| Density | 1.05±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| pka | 9.00±0.58(Predicted) |
| form | powder |
| color | White to Almost white |
| BRN | 2831927 |
| InChI | InChI=1S/C9H13BO2/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5,11-12H,1-3H3 |
| InChIKey | BZXQRXJJJUZZAJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C)C=C(C)C=C1C)(O)O |
| CAS DataBase Reference | 5980-97-2(CAS DataBase Reference) |
Description and Uses
Reactant involved in:
- Cross-coupling with α-bromocarbonyl compounds or 2,6-disubstituted bromoarenes
- Suzuki-Miyaura coupling for synthesis of biphenyl arsine ligands
- Addition reactions to naphthyridine N-oxides or β-aryloxyacrylates
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38-10 |
| Safety Statements | 37/39-26-33-29-16-3/7/9-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29209090 |
| Storage Class | 11 - Combustible Solids |






