A7776212
Tetramethylammonium sulfate hydrate , Ion to chromatography, ≥99.0% , 14190-16-0
Synonym(s):
Bis(tetramethylammonium) sulfate
CAS NO.:14190-16-0
Empirical Formula: C8H24N2O4S
Molecular Weight: 244.35
MDL number: MFCD00012139
EINECS: 238-043-4
| Pack Size | Price | Stock | Quantity |
| 2.5G | RMB704.00 | In Stock |
|
| 10G | RMB2284.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 285°C(dec.)(lit.) |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| color | White to Almost white |
| λmax | λ: 210 nm Amax: ≤0.1 λ: 220 nm Amax: ≤0.04 λ: 230 nm Amax: ≤0.03 λ: 260 nm Amax: ≤0.02 λ: 500 nm Amax: ≤0.02 |
| BRN | 3918039 |
| InChI | 1S/2C4H12N.H2O4S/c3*1-5(2,3)4/h2*1-4H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | KJFVITRRNTVAPC-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)C.C[N+](C)(C)C.[O-]S([O-])(=O)=O |
Description and Uses
Tetramethylammonium sulfate is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3 |
| HS Code | 2923.90.0100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





