A7780458
Isoimperatorin , 10mMinDMSO , 482-45-1
Synonym(s):
4-(3-Methylbut-2-enyloxy)furo[3,2-g]chromen-7-one;4-[(3-Methyl-2-buten-1-yl)oxy]-7H-furo[3,2-g][1]benzopyran-7-one
CAS NO.:482-45-1
Empirical Formula: C16H14O4
Molecular Weight: 270.28
MDL number: MFCD00272155
EINECS: 801-715-8
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107-111°C |
| Boiling point: | 448.3±45.0 °C(Predicted) |
| Density | 1.242±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly |
| form | Solid |
| color | White to Pale Yellow |
| BRN | 1291723 |
| Major Application | food and beverages |
| InChI | 1S/C16H14O4/c1-10(2)5-7-19-16-11-3-4-15(17)20-14(11)9-13-12(16)6-8-18-13/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | IGWDEVSBEKYORK-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(C(OCC=C(C)C)=C(C=CO2)C2=C3)=C3O1 |
| LogP | 3.495 (est) |
| CAS DataBase Reference | 482-45-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 7H-furo[3,2-g][1]benzopyran-7-one, 4-[(3-methyl-2-butenyl)oxy]-(482-45-1) |
Description and Uses
Anti-inflammatory. Effect on proliferation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H317-H335 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | LV1513000 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 482-45-1(Hazardous Substances Data) |





