PRODUCT Properties
| Melting point: | 160 °C |
| Boiling point: | 636.4±55.0 °C(Predicted) |
| Density | 1.423±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| pka | 13.04±0.20(Predicted) |
| form | Solid |
| color | White |
| Water Solubility | Soluble in water at 50mg/ml |
| BRN | 2331340 |
| InChI | InChI=1S/C8H15NO6/c1-4(12)9-5(2-10)7(14)8(15)6(13)3-11/h2,5-8,11,13-15H,3H2,1H3,(H,9,12)/t5-,6+,7+,8-/m0/s1 |
| InChIKey | MBLBDJOUHNCFQT-OSMVPFSASA-N |
| SMILES | O=C[C@H](NC(C)=O)[C@H]([C@H]([C@@H](CO)O)O)O |
| LogP | -2.815 (est) |
| CAS DataBase Reference | 1811-31-0(CAS DataBase Reference) |
Description and Uses
N-Acetyl-D-galactosamine is the initial O-linked sugar to many serine and threonine residues in protein glycosylation.
