A7783358
Lithospermicacid , 10mMinDMSO , 28831-65-4
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 183-188 °C |
| Boiling point: | 862.6±65.0 °C(Predicted) |
| Density | 1.642±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Soluble in methan |
| form | powder |
| pka | 2.77±0.10(Predicted) |
| color | White |
| Major Application | food and beverages |
| InChIKey | UJZQBMQZMKFSRV-RGKBJLTCSA-N |
| SMILES | O1C2=C(O)C=CC(/C=C/C(O[C@@H](C(O)=O)CC3=CC=C(O)C(O)=C3)=O)=C2[C@H](C(O)=O)[C@H]1C1=CC=C(O)C(O)=C1 |
Description and Uses
Shikoric acid has the functions of improving kidney function, preventing and treating cardiovascular diseases, and anti-oxidation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |



