N,N,N,N-Tetrakis(2-Hydroxypropyl)ethylenediamine , 98% , 102-60-3
Synonym(s):
(Ethylenedinitrilo)tetra-2-propanol;Quadrol
CAS NO.:102-60-3
Empirical Formula: C14H32N2O4
Molecular Weight: 292.41
MDL number: MFCD00004534
EINECS: 203-041-4
| Pack Size | Price | Stock | Quantity |
| 25ml | RMB23.20 | In Stock |
|
| 100ML | RMB50.40 | In Stock |
|
| 500ML | RMB200.00 | In Stock |
|
| 2.5L | RMB676.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 32°C |
| Boiling point: | 175-181 °C0.8 mm Hg(lit.) |
| Density | 1.03 g/mL at 20 °C(lit.) |
| vapor pressure | 1 mm Hg ( 20 °C) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Store below +30°C. |
| solubility | DMSO : ≥ 83.3 mg/mL (284.87 mM) |
| form | clear liquid |
| pka | 14.23±0.20(Predicted) |
| Specific Gravity | 1.013 |
| color | Colorless to Almost colorless |
| PH | 10.4 (10g/l, H2O, 20℃) |
| Water Solubility | miscible |
| Merck | 14,3599 |
| BRN | 1781143 |
| Cosmetics Ingredients Functions | CHELATING |
| InChI | 1S/C14H32N2O4/c1-11(17)7-15(8-12(2)18)5-6-16(9-13(3)19)10-14(4)20/h11-14,17-20H,5-10H2,1-4H3 |
| InChIKey | NSOXQYCFHDMMGV-UHFFFAOYSA-N |
| SMILES | CC(O)CN(CCN(CC(C)O)CC(C)O)CC(C)O |
| LogP | -2.08 at 25℃ |
| CAS DataBase Reference | 102-60-3(CAS DataBase Reference) |
| EPA Substance Registry System | N,N,N',N'-Tetrakis(2-hydroxypropyl)ethylenediamine (102-60-3) |
Description and Uses
N,N,N',N'-Tetrakis(2-hydroxypropyl)ethylenediamine (also known as Quadrol) is a monomer based on ethylenediamine used in the production of polyurethane coatings, adhesives, cosmetics and personal care products. It acts as a chelating agent due to the presence of four hydroxyl groups and as a cross-linking agent due to its two amino groups. It is widely used as a component of polymers and copolymers, especially those designed for UV crosslinked polyurethane polymers, dendritic aminopolymers, conductive polymers, inks and coatings. In addition, Quadrol is also used to produce resins, as well as in the manufacture of surfactants, plasticisers and other chemical products.
sweetener
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 43-36 |
| Safety Statements | 36/37-37-24-26 |
| WGK Germany | 3 |
| RTECS | UB5604000 |
| TSCA | TSCA listed |
| HS Code | 29221980 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 |
| Hazardous Substances Data | 102-60-3(Hazardous Substances Data) |







