A7788458
4-MethylbenzylideneCamphor , 10mMinDMSO , 36861-47-9
Synonym(s):
1,7,7-Trimethyl-3-(4-methylbenzylidene)-norbornan-2-one;1,7,7-Trimethyl-3-[(4-methylphenyl)methylene]-bicyclo[2.2.1]heptan-2-one;3-(4-Methylbenzylidene)camphor;4-MBC;4-Methylbenzylidene camphor
CAS NO.:36861-47-9
Empirical Formula: C18H22O
Molecular Weight: 254.37
MDL number: MFCD00209662
EINECS: 253-242-6
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-68°C |
| Boiling point: | 198-200 °C |
| Density | 1.064±0.06 g/cm3(Predicted) |
| RTECS | DT5099565 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | insoluble in H2O; ≥10 mg/mL in DMSO; ≥111.2 mg/mL in EtOH |
| form | Solid |
| color | White to off-white |
| BRN | 9213949 |
| Cosmetics Ingredients Functions | LIGHT STABILIZER UV ABSORBER UV FILTER |
| InChI | InChI=1S/C18H22O/c1-12-5-7-13(8-6-12)11-14-15-9-10-18(4,16(14)19)17(15,2)3/h5-8,11,15H,9-10H2,1-4H3 |
| InChIKey | HEOCBCNFKCOKBX-UHFFFAOYSA-N |
| SMILES | C12(C)C(C)(C)C(CC1)C(=CC1=CC=C(C)C=C1)C2=O |
| LogP | 3.385 (est) |
| CAS DataBase Reference | 36861-47-9(CAS DataBase Reference) |
| EPA Substance Registry System | Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl-3-[(4-methylphenyl)methylene]- (36861-47-9) |
Description and Uses
3-(4-Methylbenzyliden)camphor is an UV-B absorbing agent in sunscreen cosmetics of the type creams, lotions, lipsticks, sun oils, etc.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| Hazard Codes | Xn |
| Risk Statements | 63 |
| Safety Statements | 22-24/25-36/37 |
| WGK Germany | 2 |
| TSCA | Yes |
| HS Code | 2914399000 |



