A7789912
1-Tritylimidazole-4-carboxaldehyde , 98% , 33016-47-6
CAS NO.:33016-47-6
Empirical Formula: C23H18N2O
Molecular Weight: 338.4
MDL number: MFCD02179554
EINECS: 620-447-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.92 | In Stock |
|
| 5G | RMB193.68 | In Stock |
|
| 25G | RMB533.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-190°C |
| Boiling point: | 502.8±45.0 °C(Predicted) |
| Density | 1.10±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Acetonitrile (Slightly), Methanol (Slightly) |
| form | solid |
| pka | 2.28±0.61(Predicted) |
| color | White to brown |
| InChI | InChI=1S/C23H18N2O/c26-17-22-16-25(18-24-22)23(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-18H |
| InChIKey | YQYLLBSWWRWWAY-UHFFFAOYSA-N |
| SMILES | C1N(C(C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=C(C=O)N=1 |
| CAS DataBase Reference | 33016-47-6(CAS DataBase Reference) |
Description and Uses
1-Tritylimidazole-4-carboxaldehyde is used in the synthesis of histamine and girolline
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37 |
| Hazard Note | Irritant |
| HS Code | 29332900 |






