A7790812
3-(Trifluoromethyl)benzylamine , 98% , 2740-83-2
CAS NO.:2740-83-2
Empirical Formula: C8H8F3N
Molecular Weight: 175.15
MDL number: MFCD00008117
EINECS: 220-367-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB68.80 | In Stock |
|
| 25G | RMB270.40 | In Stock |
|
| 100G | RMB783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 176.5-178.5 °C |
| Boiling point: | 93-97 °C (22 mmHg) |
| Density | 1.222 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 160 °F |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| pka | 8.69±0.10(Predicted) |
| form | Liquid |
| Specific Gravity | 1.222 |
| color | Clear colorless to yellow |
| Water Solubility | insoluble |
| Sensitive | Air Sensitive |
| BRN | 1102465 |
| InChI | InChI=1S/C8H8F3N/c9-8(10,11)7-3-1-2-6(4-7)5-12/h1-4H,5,12H2 |
| InChIKey | YKNZTUQUXUXTLE-UHFFFAOYSA-N |
| SMILES | C1(CN)=CC=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 2740-83-2(CAS DataBase Reference) |
Description and Uses
3-(Trifluoromethyl)benzylamine has been used in the preparation of 6-substituted purines.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2735 8/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29214980 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






