A7791758
L-Argininehydrochloride , 10mMinWater , 1119-34-2
Synonym(s):
α-Amino-δ-guanidino valerianic acid hydrochloride, alpha-Amino-delta-guanidino valerianic acid hydrochloride, Arg;(S)-(+)-2-Amino-5-[(aminoiminomethyl)amino]pentanoic acid monohydrochloride;(S)-(+)-Arginine hydrochloride;L -Arginine monohydrochloride;Arg, HCl
CAS NO.:1119-34-2
Empirical Formula: C6H15ClN4O2
Molecular Weight: 210.66
MDL number: MFCD00064550
EINECS: 214-275-1
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 226-230 °C(lit.) |
| Boiling point: | 235℃[at 101 325 Pa] |
| alpha | 22 º (c=8,6N HCl) |
| Density | 1.42 |
| bulk density | 1250kg/m3 |
| vapor pressure | <1 Pa (20 °C) |
| FEMA | 3819 | L-ARGININE |
| storage temp. | 2-8°C |
| solubility | H2O: 100 mg/mL |
| form | powder |
| pka | 1[at 20 ℃] |
| color | white |
| PH | 5.5-7.0 (25℃, 1M in H2O) |
| Odor | odorless |
| PH Range | 5.5 - 7 |
| biological source | non-animal source |
| optical activity | [α]20/D +22.0±0.5°, c = 5% in 5 M HCl |
| Water Solubility | Soluble in water. Slightly soluble in hot alcohol. |
| Sensitive | Hygroscopic |
| λmax | λ: 260 nm Amax: ≤0.2 λ: 280 nm Amax: ≤0.1 |
| Merck | 14,780 |
| BRN | 3631658 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | pharmaceutical (small molecule) |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| Cosmetic Ingredient Review (CIR) | L-Arginine hydrochloride (1119-34-2) |
| InChI | 1S/C6H14N4O2.ClH/c7-4(5(11)12)2-1-3-10-6(8)9;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H/t4-;/m0./s1 |
| InChIKey | KWTQSFXGGICVPE-WCCKRBBISA-N |
| SMILES | Cl[H].N[C@@H](CCCNC(N)=N)C(O)=O |
| LogP | -8.5--3.24 at 25℃ |
| CAS DataBase Reference | 1119-34-2(CAS DataBase Reference) |
| EPA Substance Registry System | L-Arginine, monohydrochloride (1119-34-2) |
Description and Uses
L-Arginine hydrochloride is a salt form of L-Arginine, where hydrochloric acid is added to enhance stability and solubility. Arginine hydrochloride is a L-alpha-amino acid. An essential amino acid that is physiologically active in the L-form. L-Arginine might be effective at lowering blood pressure, reducing the symptoms of angina and PAD , and treating erectile dysfunction due to a physical cause.
gastric acid depressant
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 37-36/38-36/37/38-20/21/22 |
| Safety Statements | 37/39-26-24/25-36 |
| WGK Germany | 2 |
| RTECS | CF1995500 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 29252000 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 orally in Rabbit: 12000 mg/kg |




