A7792612
6-(Trifluoromethyl)indole , 97% , 13544-43-9
CAS NO.：13544-43-9
Empirical Formula: C9H6F3N
Molecular Weight: 185.15
MDL number: MFCD00272316
EINECS: 670-777-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB196.80 | In Stock |
|
| 1G | RMB418.40 | In Stock |
|
| 5g | RMB935.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101 °C |
| Boiling point: | 109-110 °C |
| Density | 1.367±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 15.59±0.30(Predicted) |
| form | solid |
| color | White to off white |
| Water Solubility | Insoluble in water. |
| BRN | 1242785 |
| InChI | InChI=1S/C9H6F3N/c10-9(11,12)7-2-1-6-3-4-13-8(6)5-7/h1-5,13H |
| InChIKey | BPYBYPREOVLFED-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(C(F)(F)F)=C2)C=C1 |
| CAS DataBase Reference | 13544-43-9(CAS DataBase Reference) |
Description and Uses
6-(Trifluoromethyl)indole is used in pharmaceutical intermediates, liquid crystal intermediates
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-25 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 2811 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 2933998090 |
