A7794612
                    3-[2-(Trifluoromethyl)phenyl]propionic acid , 97% , 94022-99-8
                            Synonym(s):
3-[2-(Trifluoromethyl)phenyl]propanoic acid
                            
                        
                CAS NO.:94022-99-8
Empirical Formula: C10H9F3O2
Molecular Weight: 218.17
MDL number: MFCD06823965
EINECS: 301-594-7
| Pack Size | Price | Stock | Quantity | 
| 1G | RMB45.60 | In Stock | 
                                                 | 
                                        
| 5G | RMB140.00 | In Stock | 
                                                 | 
                                        
| 25G | RMB483.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 84-88 °C | 
                                    
| Boiling point: | 266.9±35.0 °C(Predicted) | 
                                    
| Density | 1.307±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | Sealed in dry,Room Temperature | 
                                    
| solubility | DMSO (Slightly), Methanol (Slightly) | 
                                    
| form | Solid | 
                                    
| pka | 4.53±0.10(Predicted) | 
                                    
| color | White | 
                                    
| InChI | InChI=1S/C10H9F3O2/c11-10(12,13)8-4-2-1-3-7(8)5-6-9(14)15/h1-4H,5-6H2,(H,14,15) | 
                                    
| InChIKey | YTDVNFDGHHHPEE-UHFFFAOYSA-N | 
                                    
| SMILES | C1(CCC(O)=O)=CC=CC=C1C(F)(F)F | 
                                    
Description and Uses
3-?[2-?(Trifluoromethyl)?phenyl]?propionic Acid is a reactant used in the synthesis of small molecule inhibitors of anthrax toxin.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302-H315-H319-H335 | 
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 | 
| Hazard Codes | Xn | 
| Risk Statements | 22-36/37/38 | 
| Safety Statements | 26-36/37 | 
| WGK Germany | 3 | 
| Hazard Note | Harmful | 
| TSCA | Yes | 
| HS Code | 29163990 | 

![3-[2-(Trifluoromethyl)phenyl]propionic acid](https://img.chemicalbook.com/CAS/GIF/94022-99-8.gif)

![3-[4-(Trifluoromethyl)phenyl]propionic Acid](https://img.chemicalbook.com/CAS/GIF/53473-36-2.gif)



