A7794712
4′-(Trifluoromethyl)propiophenone , 99% , 711-33-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB46.40 | In Stock |
|
| 5G | RMB154.40 | In Stock |
|
| 25G | RMB590.40 | In Stock |
|
| 100G | RMB1977.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36-39 °C(lit.) |
| Boiling point: | 216 °C(lit.) |
| Density | 1,973 g/cm3 |
| Flash point: | 210 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | fused solid |
| color | White/colourless |
| BRN | 1874014 |
| InChI | 1S/C10H9F3O/c1-2-9(14)7-3-5-8(6-4-7)10(11,12)13/h3-6H,2H2,1H3 |
| InChIKey | QFKOWENRSZZLPK-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1ccc(cc1)C(F)(F)F |
| CAS DataBase Reference | 711-33-1(CAS DataBase Reference) |
Description and Uses
4-(Trifluoromethyl)propiophenone is used as a reagent in the preparation of ketones and alcohols in organic synthesis. It is also used as a starting material for the synthesis of various compounds such as 4-(trifluoromethyl)phenylacetic acid, which is used as a building block in the synthesis of pharmaceuticals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






