A7795712
2,4,5,6-Tetraaminopyrimidine sulfate salt , ≥98.0% , 5392-28-9
CAS NO.：5392-28-9
Empirical Formula: C4H10N6O4S
Molecular Weight: 238.22
MDL number: MFCD00012786
EINECS: 226-393-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 10G | RMB35.20 | In Stock |
|
| 50G | RMB83.20 | In Stock |
|
| 250g | RMB277.60 | In Stock |
|
| 500G | RMB455.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly, Heated), Water (Very Slightly, Heated) |
| form | Crystalline Powder |
| color | Ochre to brown |
| Water Solubility | slightly soluble |
| BRN | 3785189 |
| Cosmetics Ingredients Functions | HAIR DYEING |
| InChI | InChI=1S/C4H8N6.H2O4S/c5-1-2(6)9-4(8)10-3(1)7;1-5(2,3)4/h5H2,(H6,6,7,8,9,10);(H2,1,2,3,4) |
| InChIKey | MQEFDQWUCTUJCP-UHFFFAOYSA-N |
| SMILES | NC1=C(N=C(N)N=C1N)N.S(O)(O)(=O)=O |
| CAS DataBase Reference | 5392-28-9(CAS DataBase Reference) |
| EPA Substance Registry System | Pyrimidinetetramine, sulfate (1:1) (5392-28-9) |
Description and Uses
2,4,5,6-Tetraaminopyrimidine Sulfate is an intermediate for the synthesis of the antitumor drugs methotrexate and fludarabine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26-36 |
| WGK Germany | 3 |
| RTECS | UV9738000 |
| TSCA | Yes |
| HS Code | 29335990 |
