A7796912
4-(Trifluoromethoxy)benzyl bromide , >97.0%(GC) , 50824-05-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB366.40 | In Stock |
|
| 500g | RMB1564.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 22-24°C |
| Boiling point: | 82-84 °C10 mm Hg(lit.) |
| Density | 1.594 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 202 °F |
| storage temp. | Refrigerated. |
| solubility | soluble in Chloroform, Methanol |
| form | Liquid or Low Melting Solid |
| Specific Gravity | 1.594 |
| color | Clear faintly yellow |
| Sensitive | Lachrymatory |
| BRN | 2521451 |
| InChI | InChI=1S/C8H6BrF3O/c9-5-6-1-3-7(4-2-6)13-8(10,11)12/h1-4H,5H2 |
| InChIKey | JDNPUJCKXLOHOW-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=C(OC(F)(F)F)C=C1 |
| CAS DataBase Reference | 50824-05-0(CAS DataBase Reference) |
Description and Uses
4-(Trifluoromethoxy)benzyl bromide may be used in the synthesis of bioreductive drug, (6S)-2-nitro-6-{[4-(trifluoromethoxy)benzyl]oxy}-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PA-824).
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29093090 |
