A7797412
4-tert-Butylbenzenesulfonyl chloride , 98% , 15084-51-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB143.20 | In Stock |
|
| 100G | RMB460.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-81 °C(lit.) |
| Boiling point: | 165 °C / 18mmHg |
| Density | 1.2060 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| color | White to light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 1104346 |
| InChI | InChI=1S/C10H13ClO2S/c1-10(2,3)8-4-6-9(7-5-8)14(11,12)13/h4-7H,1-3H3 |
| InChIKey | YEZADZMMVHWFIY-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=C(C(C)(C)C)C=C1 |
| CAS DataBase Reference | 15084-51-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-T-butylbenzenesulfonyl chloride(15084-51-2) |
Description and Uses
4-tert-Butylbenzenesulfonyl Chloride can be used to treat cancer.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C |
| Risk Statements | 34-29 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
