PRODUCT Properties
| Melting point: | 136-141 °C (lit.) |
| Boiling point: | 260°C (estimate) |
| Density | 1.305 (estimate) |
| refractive index | 1.5160 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | water: soluble0.2g/10 mL, clear to almost clear, colorless to slightly brownish-yellow |
| form | Crystalline Powder |
| pka | 4.1(at 25℃) |
| color | White to slightly yellow |
| Water Solubility | 4.3 g/L (25 ºC) |
| Merck | 14,9279 |
| BRN | 1994 |
| InChI | InChI=1S/C5H4O2S/c6-5(7)4-1-2-8-3-4/h1-3H,(H,6,7) |
| InChIKey | YNVOMSDITJMNET-UHFFFAOYSA-N |
| SMILES | C1SC=CC=1C(O)=O |
| CAS DataBase Reference | 88-13-1(CAS DataBase Reference) |
Description and Uses
3-Thiophenezoic acid is a polymer monomer that can be used to synthesise thiophene derivative polymers, such as the poly(3-thiophene benzoic acid) (PTPA), the copolymer of 3-bromothiophene (BTP) and 3-thiophenezoic acid (TPA). These compounds are an important class of conductive polymers, typically exhibiting favourable electrochemical activity, environmental stability, and ease of processing.
3-Thiophenecarboxylic Acid was used as a lading compound for the development of a clinic useful D-amino acid inhibitor and have the potential to sever as active site proves to elucidate the structure-function relationships of D-amino acids.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26-36 |
| WGK Germany | 3 |
| RTECS | XM8330300 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |



