A7813812
trans-Nonachlor Standard , 1000ug/mlinPurgeandTrapMethanol , 39765-80-5
CAS NO.:39765-80-5
Empirical Formula: C10H5Cl9
Molecular Weight: 444.22
MDL number: MFCD00152673
EINECS: 622-804-6
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB1087.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148℃ |
| Boiling point: | 522.25°C (rough estimate) |
| Density | 1.7470 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| Flash point: | -26 °C |
| storage temp. | APPROX 4°C |
| form | Solid |
| BRN | 8158568 |
| Major Application | agriculture environmental |
| InChI | 1S/C10H5Cl9/c11-3-1-2(4(12)5(3)13)9(17)7(15)6(14)8(1,16)10(9,18)19/h1-5H/t1-,2+,3+,4-,5-,8-,9+ |
| InChIKey | OCHOKXCPKDPNQU-FHPNKJTRSA-N |
| SMILES | Cl[C@@H]1[C@@H](Cl)[C@H]2[C@@H]([C@H]1Cl)[C@]3(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C3(Cl)Cl |
| EPA Substance Registry System | trans-Nonachlor (39765-80-5) |
Description and Uses
trans-Nonachlordane, is an organochlorine pesticide/insecticide used in the protection of crops from pests.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H332-H351-H410 |
| Precautionary statements | P201-P273-P301+P310+P330-P304+P340+P312 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xn,N |
| Risk Statements | 11-38-48/20-51/53-62-65-67-50-36/37/38-22-36-20/21/22 |
| Safety Statements | 36/37-61-62-26-36-16-33-29-9 |
| RIDADR | UN 1208 3/PG 2 |
| WGK Germany | 3 |
| RTECS | PC0950000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
| Toxicity | LD50 orl-rat: 500 mg/kg NTIS** PB85-143766 |









