A7828812
3，4，5，6-Tetrachloropyridine-2-carboxylic acid , 98% , 10469-09-7
CAS NO.：10469-09-7
Empirical Formula: C6HCl4NO2
Molecular Weight: 260.89
MDL number: MFCD00185833
EINECS: 233-956-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB44.80 | In Stock |
|
| 5G | RMB159.20 | In Stock |
|
| 25G | RMB639.20 | In Stock |
|
| 100g | RMB1791.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-214°C |
| Boiling point: | 360.8±37.0 °C(Predicted) |
| Density | 1.824±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | DMSO, Methanol |
| pka | 1.26±0.32(Predicted) |
| form | Solid |
| color | White |
| Water Solubility | Soluble in DMSO, Methanol. Insoluble in water. |
| BRN | 479080 |
| InChI | InChI=1S/C6HCl4NO2/c7-1-2(8)4(6(12)13)11-5(10)3(1)9/h(H,12,13) |
| InChIKey | GXFRQLQUKBSYQL-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NC(Cl)=C(Cl)C(Cl)=C1Cl |
| CAS DataBase Reference | 10469-09-7(CAS DataBase Reference) |
| EPA Substance Registry System | 3,4,5,6-Tetrachloropicolinic acid (10469-09-7) |
Description and Uses
3,4,5,6-Tetrachloropyridine-2-carboxylic acid is an important raw material and intermediate used in organic synthesis, pharmaceutical and dyestuff.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 2811 |
| Hazard Note | Harmful/Irritant |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2933399990 |
