A7829612
3，3-Tetramethyleneglutaric acid , 98% , 16713-66-9
CAS NO.：16713-66-9
Empirical Formula: C9H14O4
Molecular Weight: 186.21
MDL number: MFCD00001388
EINECS: 240-761-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB72.80 | In Stock |
|
| 25G | RMB254.40 | In Stock |
|
| 100g | RMB838.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-181 °C(lit.) |
| Boiling point: | 240.69°C (rough estimate) |
| Density | 1.1006 (rough estimate) |
| refractive index | 1.4129 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | within almost transparency in Methanol |
| form | powder to crystal |
| pka | 4.42±0.10(Predicted) |
| color | White to Almost white |
| BRN | 2099523 |
| InChI | InChI=1S/C9H14O4/c10-7(11)5-9(6-8(12)13)3-1-2-4-9/h1-6H2,(H,10,11)(H,12,13) |
| InChIKey | FWPVKDFOUXHOKQ-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)(CC(O)=O)CCCC1 |
| CAS DataBase Reference | 16713-66-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 2916.20.5000 |
