A7830412
4-tert-Butylbenzoyl chloride , 98% , 1710-98-1
CAS NO.:1710-98-1
Empirical Formula: C11H13ClO
Molecular Weight: 196.67
MDL number: MFCD00000695
EINECS: 216-973-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB158.40 | In Stock |
|
| 100G | RMB599.20 | In Stock |
|
| 500G | RMB3895.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 177.5-179 °C(Solv: ligroine (8032-32-4); dichloromethane (75-09-2)) |
| Boiling point: | 135 °C20 mm Hg(lit.) |
| Density | 1.007 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 190 °F |
| storage temp. | Store below +30°C. |
| form | Liquid |
| color | Clear colorless to very slightly yellow |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| BRN | 775793 |
| InChI | 1S/C11H13ClO/c1-11(2,3)9-6-4-8(5-7-9)10(12)13/h4-7H,1-3H3 |
| InChIKey | WNLMYNASWOULQY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(cc1)C(Cl)=O |
| CAS DataBase Reference | 1710-98-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoyl chloride, 4-(1,1-dimethylethyl)-(1710-98-1) |
| EPA Substance Registry System | Benzoyl chloride, 4-(1,1-dimethylethyl)- (1710-98-1) |
Description and Uses
4-tert-Butylbenzoyl chloride is used as a reactant in the preparation of multi-branched structures based on triphenylamine for enhanced two-photon absorption.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45-24/25 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 9-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |



