![[4-(tert-butoxycarbonyl)piperazin-1-yl]acetic acid](https://img.chemicalbook.com/CAS/GIF/156478-71-6.gif)
A7831712
[4-(tert-butoxycarbonyl)piperazin-1-yl]acetic acid , ≥96%(HPLC) , 156478-71-6
Synonym(s):
2-(4-Boc-piperazino)acetic acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB98.40 | In Stock |
|
| 5G | RMB301.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 365.5±37.0 °C(Predicted) |
| Density | 1.174 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 2.40±0.10(Predicted) |
| form | Solid |
| color | Off-white to gray |
| InChI | InChI=1S/C11H20N2O4/c1-11(2,3)17-10(16)13-6-4-12(5-7-13)8-9(14)15/h4-8H2,1-3H3,(H,14,15) |
| InChIKey | WZBHMXRBXXCEDD-UHFFFAOYSA-N |
| SMILES | N1(CC(O)=O)CCN(C(OC(C)(C)C)=O)CC1 |
Description and Uses
1-Boc-4-carboxymethyl piperazine is a PROTAC linker. 1-Boc-4-carboxymethyl piperazine can be used in the synthesis of PROTACs (e.g. PROTAC IRAK4 degrader-12 (HY-168586))[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933599590 |
