A7835612
1,3,5-Tris(bromomethyl)benzene , ≥98.0%(GC) , 18226-42-1
Synonym(s):
2,4,6-Tri(bromomethyl)benzene;Tribromomesitylene
| Pack Size | Price | Stock | Quantity |
| 1G | RMB52.00 | In Stock |
|
| 5G | RMB173.60 | In Stock |
|
| 25G | RMB744.80 | In Stock |
|
| 100G | RMB2079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-99 °C |
| Boiling point: | 352.2±37.0 °C(Predicted) |
| Density | 2.005±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C9H9Br3/c10-4-7-1-8(5-11)3-9(2-7)6-12/h1-3H,4-6H2 |
| InChIKey | GHITVUOBZBZMND-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC(CBr)=CC(CBr)=C1 |
| CAS DataBase Reference | 18226-42-1(CAS DataBase Reference) |
Description and Uses
1,3,5-Tris(bromomethyl)benzene can be used to treat bacterial infections and potentiation of antibiotics.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29039990 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
