A7837012
Tris(1-chloro-2-propyl) phosphate, mixture of isomers , Analysis standard , 13674-84-5
CAS NO.:13674-84-5
Empirical Formula: C9H18Cl3O4P
Molecular Weight: 327.57
MDL number: MFCD00040408
EINECS: 237-158-7
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB255.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -39.9°C |
| Boiling point: | 270°C |
| Density | 1.28 |
| refractive index | 1.460~1.466 (20℃/D) |
| Flash point: | -218 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | liquid |
| color | Clear Colourless |
| Odor | mild odor |
| Water Solubility | <0.1 g/100 mL at 19.5 ºC |
| BRN | 1842347 |
| Stability: | Moisture Sensitive |
| Major Application | agriculture |
| InChI | 1S/C9H18Cl3O4P/c1-7(4-10)14-17(13,15-8(2)5-11)16-9(3)6-12/h7-9H,4-6H2,1-3H3 |
| InChIKey | KVMPUXDNESXNOH-UHFFFAOYSA-N |
| SMILES | CC(CCl)OP(=O)(OC(C)CCl)OC(C)CCl |
| CAS DataBase Reference | 13674-84-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Propanol, 1-chloro-, phosphate (3:1)(13674-84-5) |
| EPA Substance Registry System | Tris(1-chloro-2-propyl) phosphate (13674-84-5) |
Description and Uses
Tris(1-chloro-2-propyl) Phosphate is a flame retardant of low hydrolytic stability, used in polyurethane (PU) rigid and flexible foam, PVC, EVA, phenolics and epoxy resin.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-37 |
| WGK Germany | 1 |
| RTECS | TC9000000 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 13674-84-5(Hazardous Substances Data) |






