A7839412
Tetrahydro-3-furoic Acid , 97%, including 250ppMBHT stabilizer , 89364-31-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB45.60 | In Stock |
|
| 5G | RMB153.60 | In Stock |
|
| 25G | RMB502.40 | In Stock |
|
| 100g | RMB1638.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-130 °C |
| Boiling point: | 140 °C15 mm Hg(lit.) |
| Density | 1.214 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Acetone, Chloroform (Slightly) |
| pka | 4.33±0.20(Predicted) |
| form | Liquid |
| color | Colorless to pale yellow |
| InChI | InChI=1S/C5H8O3/c6-5(7)4-1-2-8-3-4/h4H,1-3H2,(H,6,7) |
| InChIKey | BOTREHHXSQGWTR-UHFFFAOYSA-N |
| SMILES | O1CCC(C(O)=O)C1 |
Description and Uses
Tetrahydro-3-furoic acid was used in synthesis of o-ethylphenyl tetrahydro-3-furanyl ketone.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2932190090 |
