A7839812
5-tert-butyl-2-hydroxybenzaldehyde , ≥95% , 2725-53-3
Synonym(s):
5-tert-Butylsalicylaldehyde
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB43.20 | In Stock |
|
| 1G | RMB73.60 | In Stock |
|
| 5g | RMB315.20 | In Stock |
|
| 25g | RMB1160.00 | In Stock |
|
| 100g | RMB3830.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 100-103 °C |
| Boiling point: | 251-252 °C/729 mmHg (lit.) |
| Density | 1.039 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 220 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 8.39±0.18(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C11H14O2/c1-11(2,3)9-4-5-10(13)8(6-9)7-12/h4-7,13H,1-3H3 |
| InChIKey | ZVCQQLGWGRTXGC-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(C(C)(C)C)=CC=C1O |
Description and Uses
5-tert-Butyl-2-hydroxybenzaldehyde is a general chemical reactant/reagent used in the synthesis of Vanadium (V) amino phenolato antitumor agents. As well, its used in the synthesis of dibutyltin complexes for their cytotoxic activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| HS Code | 2912490090 |
