A7840212
2,4,6-Trichloropyrimidine-5-carboxaldehyde , 98% , 50270-27-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB62.40 | In Stock |
|
| 25G | RMB224.00 | In Stock |
|
| 100g | RMB851.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131-132℃ |
| Boiling point: | 278.6±35.0 °C(Predicted) |
| Density | 1.713±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| pka | -8.75±0.39(Predicted) |
| form | Solid |
| color | White to brown |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C5HCl3N2O/c6-3-2(1-11)4(7)10-5(8)9-3/h1H |
| InChIKey | KVJIRFGNHAAUNQ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=C(C=O)C(Cl)=N1 |
Description and Uses
2,4,6-Trichloro-5-pyrimidinecarboxaldehyde is a useful reagent for organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| RIDADR | UN2811 |
| HazardClass | 6.1 |
| HS Code | 2933599590 |
