A7842112
trans-4-(4-n-Propylcyclohexyl)benzoic acid , 99% , 65355-29-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB41.60 | In Stock |
|
| 5G | RMB192.80 | In Stock |
|
| 10g | RMB299.20 | In Stock |
|
| 25G | RMB605.60 | In Stock |
|
| 100g | RMB1828.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 206°C(lit.) |
| Boiling point: | 383.7±21.0 °C(Predicted) |
| Density | 1.038±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 4.33±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C16H22O2/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(11-9-14)16(17)18/h8-13H,2-7H2,1H3,(H,17,18)/t12-,13- |
| InChIKey | VACLULPMEXHBMD-JOCQHMNTSA-N |
| SMILES | C(O)(=O)C1=CC=C([C@@H]2CC[C@@H](CCC)CC2)C=C1 |
| CAS DataBase Reference | 65355-29-5(CAS DataBase Reference) |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2916.39.7900 |
