A7844112
4,5,6,7-Tetrahydrothieno[3,2-c]pyridine Hydrochloride , ≥98.0%(HPLC) , 28783-41-7
CAS NO.:28783-41-7
Empirical Formula: C7H9NS
Molecular Weight: 139.22
MDL number: MFCD05861485
EINECS: 249-220-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB44.00 | In Stock |
|
| 25G | RMB82.40 | In Stock |
|
| 100G | RMB191.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 212-215°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO, Methanol, Water |
| form | Solid |
| color | White to Off-White |
| Major Application | pharmaceutical |
| InChI | InChI=1S/C7H9NS/c1-3-8-5-6-2-4-9-7(1)6/h2,4,8H,1,3,5H2 |
| InChIKey | OGUWOLDNYOTRBO-UHFFFAOYSA-N |
| SMILES | C12CNCCC=1SC=C2 |
| CAS DataBase Reference | 28783-41-7(CAS DataBase Reference) |
Description and Uses
An intemediate of Clopidogrel and Prasugrel.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37 |
| RIDADR | UN2811 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |

![4,5,6,7-Tetrahydrothieno[3,2-c]pyridine Hydrochloride](https://img.chemicalbook.com/CAS/GIF/28783-41-7.gif)



