A7844912
Trimethyl 1，3，5-benzenetricarboxylate , ≥98.0%(GC) , 2672-58-4
CAS NO.：2672-58-4
Empirical Formula: C12H12O6
Molecular Weight: 252.22
MDL number: MFCD00008434
EINECS: 220-215-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.00 | In Stock |
|
| 25G | RMB114.40 | In Stock |
|
| 100G | RMB396.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-147 °C(lit.) |
| Boiling point: | 230°C/0.5mmHg(lit.) |
| Density | 1.241 |
| refractive index | 1.5230 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder or Crystals |
| color | White to almost white |
| λmax | 282nm(CH3CN)(lit.) |
| BRN | 2219698 |
| InChI | InChI=1S/C12H12O6/c1-16-10(13)7-4-8(11(14)17-2)6-9(5-7)12(15)18-3/h4-6H,1-3H3 |
| InChIKey | RGCHNYAILFZUPL-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=CC(C(OC)=O)=CC(C(OC)=O)=C1 |
| CAS DataBase Reference | 2672-58-4(CAS DataBase Reference) |
Description and Uses
Trimethyl 1,3,5-benzenetricarboxylate has been used to synthesize yttrium trimesates with open frameworks.
