A7848612
2,4,5-Trifluorobenzenesulfonyl chloride, 97% , ≥97% , 220227-21-4
CAS NO.:220227-21-4
Empirical Formula: C6H2ClF3O2S
Molecular Weight: 230.59
MDL number: MFCD00077600
EINECS: 642-467-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.00 | In Stock |
|
| 5G | RMB128.00 | In Stock |
|
| 25g | RMB574.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 240.1±35.0 °C(Predicted) |
| Density | 1,657 g/cm3 |
| refractive index | 1.503 |
| Flash point: | >100°(212°F) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C6H2ClF3O2S/c7-13(11,12)6-2-4(9)3(8)1-5(6)10/h1-2H |
| InChIKey | STCZWXXRRTWRSK-UHFFFAOYSA-N |
| SMILES | Fc1cc(F)c(cc1F)S(Cl)(=O)=O |
| CAS DataBase Reference | 220227-21-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P280-P305+P351+P338-P309-P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3265 |
| WGK Germany | WGK 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2904990090 |
| Storage Class | 11 - Combustible Solids |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |



