A7850412
Trimethylolpropane tris(2-methyl-1-aziridinepropionate) , 64265-57-2
CAS NO.:64265-57-2
Empirical Formula: C24H41N3O6
Molecular Weight: 467.6
MDL number: MFCD00192542
EINECS: 264-763-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB95.20 | In Stock |
|
| 5G | RMB165.60 | In Stock |
|
| 25g | RMB240.00 | In Stock |
|
| 100g | RMB773.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -30℃ |
| Boiling point: | 532.1±50.0 °C(Predicted) |
| Density | 1.1 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | 7.31±0.40(Predicted) |
| color | Colourless |
| InChI | InChI=1S/C24H41N3O6/c1-5-24(15-31-21(28)6-9-25-12-18(25)2,16-32-22(29)7-10-26-13-19(26)3)17-33-23(30)8-11-27-14-20(27)4/h18-20H,5-17H2,1-4H3 |
| InChIKey | YKEGOEUSKXVSPN-UHFFFAOYSA-N |
| SMILES | C(OC(=O)CCN1CC1C)C(CC)(COC(=O)CCN1CC1C)COC(=O)CCN1CC1C |
| EPA Substance Registry System | Trimethylolpropane tris[3-(2-methyl-1-aziridinyl)propionate] (64265-57-2) |
Description and Uses
Trimethylolpropane Tris(2-methyl-1-aziridinepropionate) is one of the triaziridnyl compounds added as a latent curing agent for single pack self-curable polyurethane (PU) systems.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| RTECS | CM8544125 |
| TSCA | TSCA listed |






