A7852012
2,3,4,5-Tetrafluorobenzoyl chloride , 97% , 94695-48-4
CAS NO.:94695-48-4
Empirical Formula: C7HClF4O
Molecular Weight: 212.53
MDL number: MFCD00075164
EINECS: 619-058-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB71.20 | In Stock |
|
| 5G | RMB85.60 | In Stock |
|
| 25G | RMB228.00 | In Stock |
|
| 100g | RMB779.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 65-66°C 10mm |
| Density | 1.58 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 194 °F |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.580 |
| Sensitive | Moisture Sensitive |
| BRN | 5266860 |
| InChI | InChI=1S/C7HClF4O/c8-7(13)2-1-3(9)5(11)6(12)4(2)10/h1H |
| InChIKey | XWCKIXLTBNGIHV-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC(F)=C(F)C(F)=C1F |
| CAS DataBase Reference | 94695-48-4(CAS DataBase Reference) |
Description and Uses
2,3,4,5-Tetrafluorobenzoyl chloride was used in the preparation of 4-hydroxy-1-(3-pyridyl)-1-butanone-tetrafluorobenzoate. It was also used in the synthesis of N-[(4-carbamoylphenyl)carbamothioyl]-2,3,4,5-tetrafluorobenzamide.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34-37-36/37 |
| Safety Statements | 26-36/37/39-45-25 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-19-21 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





