A7862712
<i>tert</i>-Butyl 5-Norbornene-2-carboxylate (<i>endo</i>- and <i>exo</i>- mixture) , >95.0%(GC) , 154970-45-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB156.00 | In Stock |
|
| 100g | RMB596.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 243°C |
| Density | 1.046 |
| refractive index | 1.4580 to 1.4620 |
| Flash point: | 92°C |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C12H18O2/c1-12(2,3)14-11(13)10-7-8-4-5-9(10)6-8/h4-5,8-10H,6-7H2,1-3H3 |
| InChIKey | BZBMBZJUNPMEBD-UHFFFAOYSA-N |
| SMILES | C12CC(C=C1)CC2C(OC(C)(C)C)=O |
| CAS DataBase Reference | 154970-45-3(CAS DataBase Reference) |
| EPA Substance Registry System | Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 1,1-dimethylethyl ester (154970-45-3) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313-P403+P235 |
| Safety Statements | 24/25 |
| HS Code | 29162090 |




