A7869012
2,4,6-Tribromophenyl Acrylate , >98.0%(GC) , 3741-77-3
CAS NO.：3741-77-3
Empirical Formula: C9H5Br3O2
Molecular Weight: 384.85
MDL number: MFCD00078430
EINECS: 223-132-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB229.60 | In Stock |
|
| 25G | RMB767.20 | In Stock |
|
| 100g | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76.0 to 80.0 °C |
| Boiling point: | 380.8±42.0 °C(Predicted) |
| Density | 2.055±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystaline |
| color | White to Almost white |
| InChI | InChI=1S/C9H5Br3O2/c1-2-8(13)14-9-6(11)3-5(10)4-7(9)12/h2-4H,1H2 |
| InChIKey | CNLVUQQHXLTOTC-UHFFFAOYSA-N |
| SMILES | C(OC1=C(Br)C=C(Br)C=C1Br)(=O)C=C |
| CAS DataBase Reference | 3741-77-3(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4,6-Tribromophenyl acrylate (3741-77-3) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2916.12.1000 |
