A7871112
4-(Trifluoromethyl)benzenesulfonyl Chloride , >98.0%(GC)(T) , 2991-42-6
CAS NO.:2991-42-6
Empirical Formula: C7H4ClF3O2S
Molecular Weight: 244.62
MDL number: MFCD00042422
EINECS: 628-503-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB104.80 | In Stock |
|
| 100G | RMB295.20 | In Stock |
|
| 500g | RMB1360.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 30-34 °C(lit.) |
| Boiling point: | 76 °C |
| Density | 1.532±0.06 g/cm3(Predicted) |
| Flash point: | 220 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Low Melting Solid |
| color | White to pale yellow |
| Sensitive | Moisture Sensitive |
| BRN | 2113604 |
| InChI | InChI=1S/C7H4ClF3O2S/c8-14(12,13)6-3-1-5(2-4-6)7(9,10)11/h1-4H |
| InChIKey | OZDCZHDOIBUGAJ-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=C(C(F)(F)F)C=C1 |
| CAS DataBase Reference | 2991-42-6(CAS DataBase Reference) |
Description and Uses
4-(Trifluoromethyl)benzenesulfonyl chloride may be used to synthesize β-arylated thiophenes and 2,5-diarylated pyrrolevia palladium catalyzed desulfitative arylation of thiophenes and pyrroles, respectively.
4-(Trifluoromethyl)benzenesulfonyl chloride and N-vinylpyrrolidinone in acetonitrile can undergo photo-irradiation with visible light in the presence of Ir(ppy)2(dtbbpy)PF6 ([4,4′-bis(1,1-dimethylethyl)-2,2′-bipyridine-N1,N1′]bis[2-(2-pyridinyl-N)phenyl-C]iridium(III)hexafluorophosphate) and disodium phosphate to give the corresponding E-vinyl sulfone.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 22-26-36/37/39-45-26 36/37/3945 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Moisture Sensitive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |




