A7871312
3-(Trifluoromethyl)benzenesulfonyl Chloride , >98.0%(GC) , 777-44-6
CAS NO.:777-44-6
Empirical Formula: C7H4ClF3O2S
Molecular Weight: 244.62
MDL number: MFCD00014724
EINECS: 628-089-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB41.60 | In Stock |
|
| 25G | RMB141.60 | In Stock |
|
| 100G | RMB500.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-92 °C |
| Boiling point: | 88-90 °C6 mm Hg(lit.) |
| Density | 1.526 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Liquid |
| color | Clear pale yellow to brown |
| Sensitive | Moisture Sensitive |
| BRN | 2650774 |
| InChI | 1S/C7H4ClF3O2S/c8-14(12,13)6-3-1-2-5(4-6)7(9,10)11/h1-4H |
| InChIKey | ONCAZCNPWWQQMW-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 777-44-6(CAS DataBase Reference) |
Description and Uses
3-(Trifluoromethyl)benzenesulfonyl chloride can be used as a trifluoromethylating agent for the fluoroalkylation of heterocycles, aromatics, and heteroaromatics.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-25 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Corrosive/Moisture Sensitive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





