A7872212
Thionicotinamide , >98.0%(HPLC) , 4621-66-3
CAS NO.:4621-66-3
Empirical Formula: C6H6N2S
Molecular Weight: 138.19
MDL number: MFCD00006399
EINECS: 225-036-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB33.60 | In Stock |
|
| 25G | RMB104.80 | In Stock |
|
| 100g | RMB356.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185-190 °C |
| Boiling point: | 278.9±32.0 °C(Predicted) |
| Density | 1.235 (estimate) |
| refractive index | 1.5300 (estimate) |
| Flash point: | 160 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 12.01±0.29(Predicted) |
| form | Powder |
| color | Yellow to yellow-green |
| BRN | 109593 |
| InChI | InChI=1S/C6H6N2S/c7-6(9)5-2-1-3-8-4-5/h1-4H,(H2,7,9) |
| InChIKey | XQWBMZWDJAZPPX-UHFFFAOYSA-N |
| SMILES | C1=NC=CC=C1C(N)=S |
| LogP | 0.670 |
| CAS DataBase Reference | 4621-66-3(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Pyridinecarbothioamide (4621-66-3) |
Description and Uses
Thionicotinamide (TN) is an NADK inhibitor prodrug and lead compound[2]. As a lead compound, thionicotinamide sensitizes CEM-CCRF, MOLT-4, RL, and C85 cell lines to chemotherapeutic agents and reduces cellular NADP/NADPH pools[2][3].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| RTECS | QS4488000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29333990 |






![Thionicotinamide Adenine Dinucleotide oxidized form [for Biochemical Research]](https://img.chemicalbook.com/CAS/GIF/4090-29-3.gif)