A7877812
3,4,5-Trimethoxybenzoyl Chloride , >97.0%(T) , 4521-61-3
CAS NO.:4521-61-3
Empirical Formula: C10H11ClO4
Molecular Weight: 230.64
MDL number: MFCD00000675
EINECS: 224-851-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB217.60 | In Stock |
|
| 100g | RMB610.40 | In Stock |
|
| 500g | RMB3519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81-84 °C (lit.) |
| Boiling point: | 185 °C/18 mmHg (lit.) |
| Density | 1,214 g/cm3 |
| refractive index | 1.4571 (estimate) |
| Flash point: | 185°C/18mm |
| storage temp. | 2-8°C |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Orange to Green |
| Sensitive | Moisture Sensitive |
| BRN | 403117 |
| InChI | 1S/C10H11ClO4/c1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3/h4-5H,1-3H3 |
| InChIKey | BUHYMJLFRZAFBF-UHFFFAOYSA-N |
| SMILES | COc1cc(cc(OC)c1OC)C(Cl)=O |
| LogP | 2.400 (est) |
| CAS DataBase Reference | 4521-61-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,4,5-Trimethoxybenzoyl chloride(4521-61-3) |
| EPA Substance Registry System | Benzoyl chloride, 3,4,5-trimethoxy- (4521-61-3) |
Description and Uses
3,4,5-Trimethoxybenzoyl Chloride is used as a reagent in the synthesis of 2-methyl-8-(3,4,5-trimethoxybenzamido)-1,2,3,4-tetrahydroisoquinoline and its analogs which display great antihypertensive activity.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 14-34-37 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 1 |
| F | 9-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29189900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B STOT SE 3 |




