A7877912
2,4,6-Trichlorobenzoyl Chloride , >98.0%(GC)(T) , 4136-95-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB157.60 | In Stock |
|
| 25G | RMB675.20 | In Stock |
|
| 100G | RMB2375.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-166 °C |
| Boiling point: | 107-108 °C/6 mmHg (lit.) |
| Density | 1.561 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Acetonitrile (Slightly), Chloroform (Sparingly), Ethyl Acetate (Slightly) |
| form | Liquid |
| Specific Gravity | 1.561 |
| color | Clear yellow |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| BRN | 2050280 |
| InChI | 1S/C7H2Cl4O/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2H |
| InChIKey | OZGSEIVTQLXWRO-UHFFFAOYSA-N |
| SMILES | ClC(=O)c1c(Cl)cc(Cl)cc1Cl |
| CAS DataBase Reference | 4136-95-2(CAS DataBase Reference) |
Description and Uses
2,4,6-Trichlorobenzoyl chloride is a chemical compound that forms during the synthesis of benzalkonium chloride. It can be used as an efficient method for the synthesis of fatty acids and cyclic peptides. The reaction products are chlorinated and have a hydroxyl group. It is used in the synthesis of fatty acids by reacting with acetic acid to produce a chlorinated fatty acid. Hydroxyl groups react with 2,4,6-trichlorobenzoyl chloride to form a chlorinated hydroxy fatty acid.
2,4,6-Trichlorobenzoyl chloride may be used in the preparation of:
- γ-lactone and δ-lactone
- aliphatic aromatic anhydrides, required for the synthesis of amphiphilic hyaluronan
- mixed anhydride, required for the synthesis of angelate esters
- synthesis of both spongistatin 1 and spongistatin 2
- large-ring lactones in high yields.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-28-36/37/39-45-25 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |




