A7885012
2,4,6-Triamino-5-nitrosopyrimidine , >98.0%(HPLC) , 1006-23-1
Synonym(s):
2,4,6-Triamino-5-nitrosopyrimidine;Nitrosotriaminopyrimidine
CAS NO.：1006-23-1
Empirical Formula: C4H6N6O
Molecular Weight: 154.13
MDL number: MFCD00006096
EINECS: 213-742-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB130.40 | In Stock |
|
| 25G | RMB372.80 | In Stock |
|
| 100g | RMB1080.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 °C |
| Boiling point: | 277.47°C (rough estimate) |
| Density | 1.4788 (rough estimate) |
| refractive index | 1.7290 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | DMF (Slightly, Heated), DMSO (Slightly, Heated) |
| pka | 4.07±0.10(Predicted) |
| color | Light Pink to Pink |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C4H6N6O/c5-2-1(10-11)3(6)9-4(7)8-2/h(H6,5,6,7,8,9) |
| InChIKey | XLQQJSWJHHKLOK-UHFFFAOYSA-N |
| SMILES | C1(N)=NC(N)=C(N=O)C(N)=N1 |
| CAS DataBase Reference | 1006-23-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4,6-Pyrimidinetriamine, 5-nitroso- (1006-23-1) |
Description and Uses
5-Nitroso-2,4,6-triaminopyrimidine (cas# 1006-23-1) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29335990 |
