A7895012
2,4,5-Trifluoroaniline , >98.0%(GC) , 367-34-0
CAS NO.：367-34-0
Empirical Formula: C6H4F3N
Molecular Weight: 147.1
MDL number: MFCD00007649
EINECS: 206-692-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB26.40 | In Stock |
|
| 25G | RMB83.20 | In Stock |
|
| 100G | RMB296.80 | In Stock |
|
| 500g | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 59-63 °C(lit.) |
| Boiling point: | 100.5°C (rough estimate) |
| Density | 1.3510 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 2.25±0.10(Predicted) |
| form | Crystalline Powder |
| color | Beige |
| BRN | 2085734 |
| InChI | InChI=1S/C6H4F3N/c7-3-1-5(9)6(10)2-4(3)8/h1-2H,10H2 |
| InChIKey | QMYVWJVVVMIBMM-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(F)=C(F)C=C1F |
| CAS DataBase Reference | 367-34-0(CAS DataBase Reference) |
Description and Uses
2,4, 5-trifluoroaniline is a fluorinating reagent, mainly used as a raw material or intermediate in organic synthesis. It can react with acids to prepare 2,4, 5-trifluorophenacetic acid. It can also be used in the synthesis of agricultural chemicals, pharmaceuticals, dyes and special chemicals.
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H312-H331-H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P305+P351+P338-P304+P340-P405-P501a |
| Hazard Codes | Xn,Xi,T |
| Risk Statements | 20/21/22-36/37/38-41-38-21/22 |
| Safety Statements | 26-36-36/37/39 |
| RIDADR | 2941 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
