A7898312
1,2,4,5-Tetrafluorobenzene , >99.0%(GC) , 327-54-8
CAS NO.:327-54-8
Empirical Formula: C6H2F4
Molecular Weight: 150.07
MDL number: MFCD00000307
EINECS: 206-319-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB134.40 | In Stock |
|
| 100G | RMB519.20 | In Stock |
|
| 500G | RMB2172.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 4 °C (lit.) |
| Boiling point: | 90 °C (lit.) |
| Density | 1.344 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 61 °F |
| storage temp. | Sealed in dry,2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.344 |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 1909052 |
| InChI | InChI=1S/C6H2F4/c7-3-1-4(8)6(10)2-5(3)9/h1-2H |
| InChIKey | SDXUIOOHCIQXRP-UHFFFAOYSA-N |
| SMILES | C1(F)=CC(F)=C(F)C=C1F |
| CAS DataBase Reference | 327-54-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,2,4,5-tetrafluoro-(327-54-8) |
Description and Uses
It is employed as intermediate in organic synthesis. It is also used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36/37/39-37/39-33-7/9 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Flammable/Irritant |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






